C23H25BrO4 — CID 172994912
7-(8-bromooctoxy)-5-hydroxy-2-phenylchromen-4-one (PubChem CID 172994912) has the molecular formula C23H25BrO4 and a molecular weight of 445.35 g/mol. Its IUPAC name is 7-(8-bromooctoxy)-5-hydroxy-2-phenylchromen-4-one.
| Compound Name | 7-(8-bromooctoxy)-5-hydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 172994912 |
| Molecular Formula | C23H25BrO4 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 7-(8-bromooctoxy)-5-hydroxy-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OCCCCCCCCBr)cc(O)c12 |
| InChI | InChI=1S/C23H25BrO4/c24-12-8-3-1-2-4-9-13-27-18-14-19(25)23-20(26)16-21(28-22(23)15-18)17-10-6-5-7-11-17/h5-7,10-11,14-16,25H,1-4,8-9,12-13H2 |
| InChIKey | MYLLSSFZJOYODK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|