C22H23BrO4 — CID 91144753
7-(4-bromo-2,4-dimethylpentan-2-yl)oxy-5-hydroxy-2-phenylchromen-4-one (PubChem CID 91144753) has the molecular formula C22H23BrO4 and a molecular weight of 431.33 g/mol. Its IUPAC name is 7-(4-bromo-2,4-dimethylpentan-2-yl)oxy-5-hydroxy-2-phenylchromen-4-one.
| Compound Name | 7-(4-bromo-2,4-dimethylpentan-2-yl)oxy-5-hydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 91144753 |
| Molecular Formula | C22H23BrO4 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 7-(4-bromo-2,4-dimethylpentan-2-yl)oxy-5-hydroxy-2-phenylchromen-4-one |
| SMILES | CC(C)(Br)CC(C)(C)Oc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1 |
| InChI | InChI=1S/C22H23BrO4/c1-21(2,23)13-22(3,4)27-15-10-16(24)20-17(25)12-18(26-19(20)11-15)14-8-6-5-7-9-14/h5-12,24H,13H2,1-4H3 |
| InChIKey | WJVFIZMVPNRORQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|