C18H13O6- — CID 6920592
(2R)-2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxypropanoate (PubChem CID 6920592) has the molecular formula C18H13O6- and a molecular weight of 325.30 g/mol. Its IUPAC name is (2R)-2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxypropanoate.
| Compound Name | (2R)-2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxypropanoate |
|---|---|
| PubChem CID | 6920592 |
| Molecular Formula | C18H13O6- |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (2R)-2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxypropanoate |
| SMILES | C[C@@H](Oc1cc(O)c2c(=O)cc(-c3ccccc3)oc2c1)C(=O)[O-] |
| InChI | InChI=1S/C18H14O6/c1-10(18(21)22)23-12-7-13(19)17-14(20)9-15(24-16(17)8-12)11-5-3-2-4-6-11/h2-10,19H,1H3,(H,21,22)/p-1/t10-/m1/s1 |
| InChIKey | YOQVHERGOVICCE-SNVBAGLBSA-M |
| XLogP | 1.68 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |