C20H20O6 — CID 130230703
2-[4-(2,3-dihydroxypropoxy)phenyl]-5-methoxy-7-methylchromen-4-one (PubChem CID 130230703) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroxypropoxy)phenyl]-5-methoxy-7-methylchromen-4-one.
| Compound Name | 2-[4-(2,3-dihydroxypropoxy)phenyl]-5-methoxy-7-methylchromen-4-one |
|---|---|
| PubChem CID | 130230703 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-[4-(2,3-dihydroxypropoxy)phenyl]-5-methoxy-7-methylchromen-4-one |
| SMILES | COc1cc(C)cc2oc(-c3ccc(OCC(O)CO)cc3)cc(=O)c12 |
| InChI | InChI=1S/C20H20O6/c1-12-7-18(24-2)20-16(23)9-17(26-19(20)8-12)13-3-5-15(6-4-13)25-11-14(22)10-21/h3-9,14,21-22H,10-11H2,1-2H3 |
| InChIKey | VEBSVKYAZVPLAQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |