C19H12N2O6 — CID 175017796
2-[4-[7-(cyanomethoxy)-5-hydroxy-4-oxochromen-2-yl]-2-hydroxyphenoxy]acetonitrile (PubChem CID 175017796) has the molecular formula C19H12N2O6 and a molecular weight of 364.31 g/mol. Its IUPAC name is 2-[4-[7-(cyanomethoxy)-5-hydroxy-4-oxochromen-2-yl]-2-hydroxyphenoxy]acetonitrile.
| Compound Name | 2-[4-[7-(cyanomethoxy)-5-hydroxy-4-oxochromen-2-yl]-2-hydroxyphenoxy]acetonitrile |
|---|---|
| PubChem CID | 175017796 |
| Molecular Formula | C19H12N2O6 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[4-[7-(cyanomethoxy)-5-hydroxy-4-oxochromen-2-yl]-2-hydroxyphenoxy]acetonitrile |
| SMILES | N#CCOc1cc(O)c2c(=O)cc(-c3ccc(OCC#N)c(O)c3)oc2c1 |
| InChI | InChI=1S/C19H12N2O6/c20-3-5-25-12-8-14(23)19-15(24)10-17(27-18(19)9-12)11-1-2-16(13(22)7-11)26-6-4-21/h1-2,7-10,22-23H,5-6H2 |
| InChIKey | AAYITBMEYRBLIA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |