C20H17NO5 — CID 59331782
2-[5-methoxy-2-(3-methoxy-4-methylphenyl)-4-oxochromen-7-yl]oxyacetonitrile (PubChem CID 59331782) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[5-methoxy-2-(3-methoxy-4-methylphenyl)-4-oxochromen-7-yl]oxyacetonitrile.
| Compound Name | 2-[5-methoxy-2-(3-methoxy-4-methylphenyl)-4-oxochromen-7-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 59331782 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[5-methoxy-2-(3-methoxy-4-methylphenyl)-4-oxochromen-7-yl]oxyacetonitrile |
| SMILES | COc1cc(-c2cc(=O)c3c(OC)cc(OCC#N)cc3o2)ccc1C |
| InChI | InChI=1S/C20H17NO5/c1-12-4-5-13(8-16(12)23-2)17-11-15(22)20-18(24-3)9-14(25-7-6-21)10-19(20)26-17/h4-5,8-11H,7H2,1-3H3 |
| InChIKey | ARBUKVACPBFJCM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 81.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |