C23H21NO6 — CID 15389638
2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxyacetonitrile (PubChem CID 15389638) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxyacetonitrile.
| Compound Name | 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 15389638 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxyacetonitrile |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)cc(OCC#N)cc3o2)cc1OC1CCCC1 |
| InChI | InChI=1S/C23H21NO6/c1-27-19-7-6-14(10-21(19)29-15-4-2-3-5-15)20-13-18(26)23-17(25)11-16(28-9-8-24)12-22(23)30-20/h6-7,10-13,15,25H,2-5,9H2,1H3 |
| InChIKey | NOMXWQXPURCYDY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |