C27H30N2O7 — CID 54393802
2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-7-(2-imino-2-morpholin-4-ylethoxy)chromen-4-one (PubChem CID 54393802) has the molecular formula C27H30N2O7 and a molecular weight of 494.54 g/mol. Its IUPAC name is 2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-7-(2-imino-2-morpholin-4-ylethoxy)chromen-4-one.
| Compound Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-7-(2-imino-2-morpholin-4-ylethoxy)chromen-4-one |
|---|---|
| PubChem CID | 54393802 |
| Molecular Formula | C27H30N2O7 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | 2-(3-cyclopentyloxy-4-methoxyphenyl)-5-hydroxy-7-(2-imino-2-morpholin-4-ylethoxy)chromen-4-one |
| SMILES | [H]/N=C(/COc1cc(O)c2c(=O)cc(-c3ccc(OC)c(OC4CCCC4)c3)oc2c1)N1CCOCC1 |
| InChI | InChI=1S/C27H30N2O7/c1-32-22-7-6-17(12-24(22)35-18-4-2-3-5-18)23-15-21(31)27-20(30)13-19(14-25(27)36-23)34-16-26(28)29-8-10-33-11-9-29/h6-7,12-15,18,28,30H,2-5,8-11,16H2,1H3/b28-26- |
| InChIKey | VIMZMQTWWUTKRL-SGEDCAFJSA-N |
| XLogP | 4.18 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|