C22H24ClNO6 — CID 142688405
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-(2-piperidin-1-ylethoxy)chromen-4-one;hydrochloride (PubChem CID 142688405) has the molecular formula C22H24ClNO6 and a molecular weight of 433.89 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-(2-piperidin-1-ylethoxy)chromen-4-one;hydrochloride.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-(2-piperidin-1-ylethoxy)chromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 142688405 |
| Molecular Formula | C22H24ClNO6 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-(2-piperidin-1-ylethoxy)chromen-4-one;hydrochloride |
| SMILES | Cl.O=c1cc(-c2ccc(O)c(O)c2)oc2cc(OCCN3CCCCC3)cc(O)c12 |
| InChI | InChI=1S/C22H23NO6.ClH/c24-16-5-4-14(10-17(16)25)20-13-19(27)22-18(26)11-15(12-21(22)29-20)28-9-8-23-6-2-1-3-7-23;/h4-5,10-13,24-26H,1-3,6-9H2;1H |
| InChIKey | VTURLNUDNWUEST-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|