C21H22ClNO8 — CID 142688406
5-hydroxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride (PubChem CID 142688406) has the molecular formula C21H22ClNO8 and a molecular weight of 451.86 g/mol. Its IUPAC name is 5-hydroxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride.
| Compound Name | 5-hydroxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 142688406 |
| Molecular Formula | C21H22ClNO8 |
| Molecular Weight | 451.86 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 5-hydroxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride |
| SMILES | Cl.O=c1cc(-c2cc(O)c(O)c(O)c2)oc2cc(OCCN3CCOCC3)cc(O)c12 |
| InChI | InChI=1S/C21H21NO8.ClH/c23-14-9-13(29-6-3-22-1-4-28-5-2-22)10-19-20(14)15(24)11-18(30-19)12-7-16(25)21(27)17(26)8-12;/h7-11,23,25-27H,1-6H2;1H |
| InChIKey | SPLFUKPFHJODAG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.86 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|