C21H21NO5 — CID 162359881
2-(4-hydroxyphenyl)-7-(2-morpholin-4-ylethoxy)chromen-4-one (PubChem CID 162359881) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-7-(2-morpholin-4-ylethoxy)chromen-4-one.
| Compound Name | 2-(4-hydroxyphenyl)-7-(2-morpholin-4-ylethoxy)chromen-4-one |
|---|---|
| PubChem CID | 162359881 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(4-hydroxyphenyl)-7-(2-morpholin-4-ylethoxy)chromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(OCCN3CCOCC3)ccc12 |
| InChI | InChI=1S/C21H21NO5/c23-16-3-1-15(2-4-16)20-14-19(24)18-6-5-17(13-21(18)27-20)26-12-9-22-7-10-25-11-8-22/h1-6,13-14,23H,7-12H2 |
| InChIKey | XRZWWKOTVBETQI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |