C28H29NO4 — CID 155535063
7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol (PubChem CID 155535063) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol.
| Compound Name | 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 155535063 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol |
| SMILES | Oc1ccc(C2=C(c3ccc(OCCN4CCOCC4)cc3)c3cc(O)ccc3CC2)cc1 |
| InChI | InChI=1S/C28H29NO4/c30-23-7-1-20(2-8-23)26-12-6-21-3-9-24(31)19-27(21)28(26)22-4-10-25(11-5-22)33-18-15-29-13-16-32-17-14-29/h1-5,7-11,19,30-31H,6,12-18H2 |
| InChIKey | DNDTVCLTHBYPLR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|