About 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol
7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol (PubChem CID 155535063) has the molecular formula C28H29NO4
and a molecular weight of 443.54 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol.
Molecular Properties
| Compound Name | 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol |
| PubChem CID | 155535063 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol |
| SMILES | Oc1ccc(C2=C(c3ccc(OCCN4CCOCC4)cc3)c3cc(O)ccc3CC2)cc1 |
| InChI | InChI=1S/C28H29NO4/c30-23-7-1-20(2-8-23)26-12-6-21-3-9-24(31)19-27(21)28(26)22-4-10-25(11-5-22)33-18-15-29-13-16-32-17-14-29/h1-5,7-11,19,30-31H,6,12-18H2 |
| InChIKey | DNDTVCLTHBYPLR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol?
The IUPAC name of 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol (CID 155535063) is 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol.
What is the SMILES notation for 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol?
The canonical SMILES for 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol is Oc1ccc(C2=C(c3ccc(OCCN4CCOCC4)cc3)c3cc(O)ccc3CC2)cc1.
What is the InChIKey of 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol?
The InChIKey is DNDTVCLTHBYPLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO4/c30-23-7-1-20(2-8-23)26-12-6-21-3-9-24(31)19-27(21)28(26)22-4-10-25(11-5-22)33-18-15-29-13-16-32-17-14-29/h1-5,7-11,19,30-31H,6,12-18H2.
What are the key properties of 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol?
7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol has a molecular weight of 443.54 g/mol, XLogP of 4.71, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-hydroxyphenyl)-8-[4-(2-morpholin-4-ylethoxy)phenyl]-5,6-dihydronaphthalen-2-ol is sourced from PubChem (CID 155535063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).