C28H31NO3 — CID 155532894
7-(4-hydroxyphenyl)-8-[4-[2-[methyl(propyl)amino]ethoxy]phenyl]-5,6-dihydronaphthalen-2-ol (PubChem CID 155532894) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is 7-(4-hydroxyphenyl)-8-[4-[2-[methyl(propyl)amino]ethoxy]phenyl]-5,6-dihydronaphthalen-2-ol.
| Compound Name | 7-(4-hydroxyphenyl)-8-[4-[2-[methyl(propyl)amino]ethoxy]phenyl]-5,6-dihydronaphthalen-2-ol |
|---|---|
| PubChem CID | 155532894 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 7-(4-hydroxyphenyl)-8-[4-[2-[methyl(propyl)amino]ethoxy]phenyl]-5,6-dihydronaphthalen-2-ol |
| SMILES | CCCN(C)CCOc1ccc(C2=C(c3ccc(O)cc3)CCc3ccc(O)cc32)cc1 |
| InChI | InChI=1S/C28H31NO3/c1-3-16-29(2)17-18-32-25-13-7-22(8-14-25)28-26(20-4-10-23(30)11-5-20)15-9-21-6-12-24(31)19-27(21)28/h4-8,10-14,19,30-31H,3,9,15-18H2,1-2H3 |
| InChIKey | JSTVRBMRIFDJDS-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|