C29H33BN2O3 — CID 174285518
[4-[7-hydroxy-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-3,4-dihydronaphthalen-2-yl]phenyl]boronic acid (PubChem CID 174285518) has the molecular formula C29H33BN2O3 and a molecular weight of 468.41 g/mol. Its IUPAC name is [4-[7-hydroxy-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-3,4-dihydronaphthalen-2-yl]phenyl]boronic acid.
| Compound Name | [4-[7-hydroxy-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-3,4-dihydronaphthalen-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 174285518 |
| Molecular Formula | C29H33BN2O3 |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | [4-[7-hydroxy-1-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-3,4-dihydronaphthalen-2-yl]phenyl]boronic acid |
| SMILES | CC(C)N1CCN(c2ccc(C3=C(c4ccc(B(O)O)cc4)CCc4ccc(O)cc43)cc2)CC1 |
| InChI | InChI=1S/C29H33BN2O3/c1-20(2)31-15-17-32(18-16-31)25-11-5-23(6-12-25)29-27(21-3-9-24(10-4-21)30(34)35)14-8-22-7-13-26(33)19-28(22)29/h3-7,9-13,19-20,33-35H,8,14-18H2,1-2H3 |
| InChIKey | PNSVGCOSKSENRQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|