C32H36N2O3 — CID 171637487
methyl 6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate (PubChem CID 171637487) has the molecular formula C32H36N2O3 and a molecular weight of 496.65 g/mol. Its IUPAC name is methyl 6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 171637487 |
| Molecular Formula | C32H36N2O3 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | methyl 6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCC(c1ccc(OC)cc1)=C2c1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C32H36N2O3/c1-22(2)33-17-19-34(20-18-33)27-11-5-24(6-12-27)31-29(23-7-13-28(36-3)14-8-23)15-9-25-21-26(32(35)37-4)10-16-30(25)31/h5-8,10-14,16,21-22H,9,15,17-20H2,1-4H3 |
| InChIKey | GEKFAUIZVWRPJI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|