C30H32F2N2O — CID 171637426
1-[4-[2-(2,4-difluorophenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]-4-propan-2-ylpiperazine (PubChem CID 171637426) has the molecular formula C30H32F2N2O and a molecular weight of 474.60 g/mol. Its IUPAC name is 1-[4-[2-(2,4-difluorophenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]-4-propan-2-ylpiperazine.
| Compound Name | 1-[4-[2-(2,4-difluorophenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]-4-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 171637426 |
| Molecular Formula | C30H32F2N2O |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 1-[4-[2-(2,4-difluorophenyl)-6-methoxy-3,4-dihydronaphthalen-1-yl]phenyl]-4-propan-2-ylpiperazine |
| SMILES | COc1ccc2c(c1)CCC(c1ccc(F)cc1F)=C2c1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C30H32F2N2O/c1-20(2)33-14-16-34(17-15-33)24-8-4-21(5-9-24)30-26-13-10-25(35-3)18-22(26)6-11-28(30)27-12-7-23(31)19-29(27)32/h4-5,7-10,12-13,18-20H,6,11,14-17H2,1-3H3 |
| InChIKey | OKVQUFYGGKKRCA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|