C30H36BClN2O3 — CID 171637515
[6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalen-2-yl]boronic acid;hydrochloride (PubChem CID 171637515) has the molecular formula C30H36BClN2O3 and a molecular weight of 518.89 g/mol. Its IUPAC name is [6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalen-2-yl]boronic acid;hydrochloride.
| Compound Name | [6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalen-2-yl]boronic acid;hydrochloride |
|---|---|
| PubChem CID | 171637515 |
| Molecular Formula | C30H36BClN2O3 |
| Molecular Weight | 518.89 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | [6-(4-methoxyphenyl)-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalen-2-yl]boronic acid;hydrochloride |
| SMILES | COc1ccc(C2=C(c3ccc(N4CCN(C(C)C)CC4)cc3)c3ccc(B(O)O)cc3CC2)cc1.Cl |
| InChI | InChI=1S/C30H35BN2O3.ClH/c1-21(2)32-16-18-33(19-17-32)26-10-4-23(5-11-26)30-28(22-6-12-27(36-3)13-7-22)14-8-24-20-25(31(34)35)9-15-29(24)30;/h4-7,9-13,15,20-21,34-35H,8,14,16-19H2,1-3H3;1H |
| InChIKey | ZXIQWSVTKBACOZ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.89 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|