C25H29BrN2O2 — CID 171637549
methyl 6-bromo-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate (PubChem CID 171637549) has the molecular formula C25H29BrN2O2 and a molecular weight of 469.42 g/mol. Its IUPAC name is methyl 6-bromo-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 6-bromo-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 171637549 |
| Molecular Formula | C25H29BrN2O2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 6-bromo-5-[4-(4-propan-2-ylpiperazin-1-yl)phenyl]-7,8-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCC(Br)=C2c1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C25H29BrN2O2/c1-17(2)27-12-14-28(15-13-27)21-8-4-18(5-9-21)24-22-10-6-20(25(29)30-3)16-19(22)7-11-23(24)26/h4-6,8-10,16-17H,7,11-15H2,1-3H3 |
| InChIKey | LCPKESZOOYKMNE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|