C20H18BrIO2 — CID 163263094
methyl 6-bromo-5-(4-iodophenyl)-7-methyl-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate (PubChem CID 163263094) has the molecular formula C20H18BrIO2 and a molecular weight of 497.17 g/mol. Its IUPAC name is methyl 6-bromo-5-(4-iodophenyl)-7-methyl-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate.
| Compound Name | methyl 6-bromo-5-(4-iodophenyl)-7-methyl-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
|---|---|
| PubChem CID | 163263094 |
| Molecular Formula | C20H18BrIO2 |
| Molecular Weight | 497.17 g/mol |
| Exact Mass | 495.95 |
| IUPAC Name | methyl 6-bromo-5-(4-iodophenyl)-7-methyl-8,9-dihydro-7H-benzo[7]annulene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CCC(C)C(Br)=C2c1ccc(I)cc1 |
| InChI | InChI=1S/C20H18BrIO2/c1-12-3-4-14-11-15(20(23)24-2)7-10-17(14)18(19(12)21)13-5-8-16(22)9-6-13/h5-12H,3-4H2,1-2H3 |
| InChIKey | LTULFMGDCDZTDF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.17 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|