C20H16O4 — CID 22669999
methyl 3,4-bis(4-hydroxyphenyl)benzoate (PubChem CID 22669999) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is methyl 3,4-bis(4-hydroxyphenyl)benzoate.
| Compound Name | methyl 3,4-bis(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 22669999 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | methyl 3,4-bis(4-hydroxyphenyl)benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(O)cc2)c(-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C20H16O4/c1-24-20(23)15-6-11-18(13-2-7-16(21)8-3-13)19(12-15)14-4-9-17(22)10-5-14/h2-12,21-22H,1H3 |
| InChIKey | GZXULPYLAKARGW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |