About 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate
4-hydroxybenzoic acid;methyl 4-hydroxybenzoate (PubChem CID 67377011) has the molecular formula C15H14O6
and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate |
| PubChem CID | 67377011 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate |
| SMILES | COC(=O)c1ccc(O)cc1.O=C(O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O3.C7H6O3/c1-11-8(10)6-2-4-7(9)5-3-6;8-6-3-1-5(2-4-6)7(9)10/h2-5,9H,1H3;1-4,8H,(H,9,10) |
| InChIKey | ZHEQHAPVGOFDBR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate?
The IUPAC name of 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate (CID 67377011) is 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate.
What is the SMILES notation for 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate?
The canonical SMILES for 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate is COC(=O)c1ccc(O)cc1.O=C(O)c1ccc(O)cc1.
What is the InChIKey of 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate?
The InChIKey is ZHEQHAPVGOFDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C7H6O3/c1-11-8(10)6-2-4-7(9)5-3-6;8-6-3-1-5(2-4-6)7(9)10/h2-5,9H,1H3;1-4,8H,(H,9,10).
What are the key properties of 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate?
4-hydroxybenzoic acid;methyl 4-hydroxybenzoate has a molecular weight of 290.27 g/mol, XLogP of 2.27, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxybenzoic acid;methyl 4-hydroxybenzoate is sourced from PubChem (CID 67377011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).