C20H22O10 — CID 174780069
dimethyl benzene-1,4-dicarboxylate;ethane-1,2-diol;terephthalic acid (PubChem CID 174780069) has the molecular formula C20H22O10 and a molecular weight of 422.39 g/mol. Its IUPAC name is dimethyl benzene-1,4-dicarboxylate;ethane-1,2-diol;terephthalic acid.
| Compound Name | dimethyl benzene-1,4-dicarboxylate;ethane-1,2-diol;terephthalic acid |
|---|---|
| PubChem CID | 174780069 |
| Molecular Formula | C20H22O10 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | dimethyl benzene-1,4-dicarboxylate;ethane-1,2-diol;terephthalic acid |
| SMILES | COC(=O)c1ccc(C(=O)OC)cc1.O=C(O)c1ccc(C(=O)O)cc1.OCCO |
| InChI | InChI=1S/C10H10O4.C8H6O4.C2H6O2/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2;9-7(10)5-1-2-6(4-3-5)8(11)12;3-1-2-4/h3-6H,1-2H3;1-4H,(H,9,10)(H,11,12);3-4H,1-2H2 |
| InChIKey | KDNHNUBMBGNHRZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |