C30H34BN2O2 — CID 174285585
CID 174285585 (PubChem CID 174285585) has the molecular formula C30H34BN2O2 and a molecular weight of 465.43 g/mol.
| Compound Name | CID 174285585 |
|---|---|
| PubChem CID | 174285585 |
| Molecular Formula | C30H34BN2O2 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | — |
| SMILES | COc1ccc2c(c1)CCC(c1ccc([B]O)cc1)=C2c1ccc(N2CCN(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C30H34BN2O2/c1-21(2)32-16-18-33(19-17-32)26-11-6-23(7-12-26)30-28(22-4-9-25(31-34)10-5-22)14-8-24-20-27(35-3)13-15-29(24)30/h4-7,9-13,15,20-21,34H,8,14,16-19H2,1-3H3 |
| InChIKey | PRPOPQKIHVRCJZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|