C27H34BrNO3 — CID 170705584
1-[4-(6-bromo-2-methoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-4-(dimethoxymethyl)piperidine (PubChem CID 170705584) has the molecular formula C27H34BrNO3 and a molecular weight of 500.48 g/mol. Its IUPAC name is 1-[4-(6-bromo-2-methoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-4-(dimethoxymethyl)piperidine.
| Compound Name | 1-[4-(6-bromo-2-methoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-4-(dimethoxymethyl)piperidine |
|---|---|
| PubChem CID | 170705584 |
| Molecular Formula | C27H34BrNO3 |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 1-[4-(6-bromo-2-methoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenyl]-4-(dimethoxymethyl)piperidine |
| SMILES | COc1ccc2c(c1)CCC(C)C(Br)=C2c1ccc(N2CCC(C(OC)OC)CC2)cc1 |
| InChI | InChI=1S/C27H34BrNO3/c1-18-5-6-21-17-23(30-2)11-12-24(21)25(26(18)28)19-7-9-22(10-8-19)29-15-13-20(14-16-29)27(31-3)32-4/h7-12,17-18,20,27H,5-6,13-16H2,1-4H3 |
| InChIKey | NSIIIRSFISJMMS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|