C36H38N2O3 — CID 170706322
4-[1-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-phenylmethoxy-3,4-dihydronaphthalen-2-yl]pyridine (PubChem CID 170706322) has the molecular formula C36H38N2O3 and a molecular weight of 546.71 g/mol. Its IUPAC name is 4-[1-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-phenylmethoxy-3,4-dihydronaphthalen-2-yl]pyridine.
| Compound Name | 4-[1-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-phenylmethoxy-3,4-dihydronaphthalen-2-yl]pyridine |
|---|---|
| PubChem CID | 170706322 |
| Molecular Formula | C36H38N2O3 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 4-[1-[4-[4-(dimethoxymethyl)piperidin-1-yl]phenyl]-6-phenylmethoxy-3,4-dihydronaphthalen-2-yl]pyridine |
| SMILES | COC(OC)C1CCN(c2ccc(C3=C(c4ccncc4)CCc4cc(OCc5ccccc5)ccc43)cc2)CC1 |
| InChI | InChI=1S/C36H38N2O3/c1-39-36(40-2)29-18-22-38(23-19-29)31-11-8-28(9-12-31)35-33(27-16-20-37-21-17-27)14-10-30-24-32(13-15-34(30)35)41-25-26-6-4-3-5-7-26/h3-9,11-13,15-17,20-21,24,29,36H,10,14,18-19,22-23,25H2,1-2H3 |
| InChIKey | INVQYOAUBGMQLU-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|