C35H40BrNO4 — CID 170729147
7-[4-(2-bromo-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)-3-methoxyphenyl]-2-(dimethoxymethyl)-7-azaspiro[3.5]nonane (PubChem CID 170729147) has the molecular formula C35H40BrNO4 and a molecular weight of 618.61 g/mol. Its IUPAC name is 7-[4-(2-bromo-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)-3-methoxyphenyl]-2-(dimethoxymethyl)-7-azaspiro[3.5]nonane.
| Compound Name | 7-[4-(2-bromo-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)-3-methoxyphenyl]-2-(dimethoxymethyl)-7-azaspiro[3.5]nonane |
|---|---|
| PubChem CID | 170729147 |
| Molecular Formula | C35H40BrNO4 |
| Molecular Weight | 618.61 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 7-[4-(2-bromo-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)-3-methoxyphenyl]-2-(dimethoxymethyl)-7-azaspiro[3.5]nonane |
| SMILES | COc1cc(N2CCC3(CC2)CC(C(OC)OC)C3)ccc1C1=C(Br)CCc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C35H40BrNO4/c1-38-32-20-27(37-17-15-35(16-18-37)21-26(22-35)34(39-2)40-3)10-12-30(32)33-29-13-11-28(19-25(29)9-14-31(33)36)41-23-24-7-5-4-6-8-24/h4-8,10-13,19-20,26,34H,9,14-18,21-23H2,1-3H3 |
| InChIKey | DVDNAUPTIZYEDB-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.61 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|