C32H37NO3 — CID 170706291
4-(dimethoxymethyl)-1-[4-(2-methyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]piperidine (PubChem CID 170706291) has the molecular formula C32H37NO3 and a molecular weight of 483.65 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1-[4-(2-methyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]piperidine.
| Compound Name | 4-(dimethoxymethyl)-1-[4-(2-methyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 170706291 |
| Molecular Formula | C32H37NO3 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 4-(dimethoxymethyl)-1-[4-(2-methyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]piperidine |
| SMILES | COC(OC)C1CCN(c2ccc(C3=C(C)CCc4cc(OCc5ccccc5)ccc43)cc2)CC1 |
| InChI | InChI=1S/C32H37NO3/c1-23-9-10-27-21-29(36-22-24-7-5-4-6-8-24)15-16-30(27)31(23)25-11-13-28(14-12-25)33-19-17-26(18-20-33)32(34-2)35-3/h4-8,11-16,21,26,32H,9-10,17-20,22H2,1-3H3 |
| InChIKey | MUWIKLQWUCHGQX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|