C37H39NO4 — CID 134579714
(3S)-3-(2,2-dimethoxyethoxy)-1-[4-(2-phenyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine (PubChem CID 134579714) has the molecular formula C37H39NO4 and a molecular weight of 561.72 g/mol. Its IUPAC name is (3S)-3-(2,2-dimethoxyethoxy)-1-[4-(2-phenyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine.
| Compound Name | (3S)-3-(2,2-dimethoxyethoxy)-1-[4-(2-phenyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 134579714 |
| Molecular Formula | C37H39NO4 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | (3S)-3-(2,2-dimethoxyethoxy)-1-[4-(2-phenyl-6-phenylmethoxy-3,4-dihydronaphthalen-1-yl)phenyl]pyrrolidine |
| SMILES | COC(CO[C@H]1CCN(c2ccc(C3=C(c4ccccc4)CCc4cc(OCc5ccccc5)ccc43)cc2)C1)OC |
| InChI | InChI=1S/C37H39NO4/c1-39-36(40-2)26-42-33-21-22-38(24-33)31-16-13-29(14-17-31)37-34(28-11-7-4-8-12-28)19-15-30-23-32(18-20-35(30)37)41-25-27-9-5-3-6-10-27/h3-14,16-18,20,23,33,36H,15,19,21-22,24-26H2,1-2H3/t33-/m0/s1 |
| InChIKey | PAXKOUIRXOPGGQ-XIFFEERXSA-N |
| XLogP | 7.39 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|