C24H21BrO2S — CID 134579928
3-bromo-4-(4-methoxysulfanylphenyl)-7-phenylmethoxy-1,2-dihydronaphthalene (PubChem CID 134579928) has the molecular formula C24H21BrO2S and a molecular weight of 453.40 g/mol. Its IUPAC name is 3-bromo-4-(4-methoxysulfanylphenyl)-7-phenylmethoxy-1,2-dihydronaphthalene.
| Compound Name | 3-bromo-4-(4-methoxysulfanylphenyl)-7-phenylmethoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 134579928 |
| Molecular Formula | C24H21BrO2S |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 3-bromo-4-(4-methoxysulfanylphenyl)-7-phenylmethoxy-1,2-dihydronaphthalene |
| SMILES | COSc1ccc(C2=C(Br)CCc3cc(OCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C24H21BrO2S/c1-26-28-21-11-7-18(8-12-21)24-22-13-10-20(15-19(22)9-14-23(24)25)27-16-17-5-3-2-4-6-17/h2-8,10-13,15H,9,14,16H2,1H3 |
| InChIKey | AIWRZGUBLKEFBW-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|