C19H18O2 — CID 23121517
1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde (PubChem CID 23121517) has the molecular formula C19H18O2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde.
| Compound Name | 1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 23121517 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1-methyl-6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde |
| SMILES | CC1=C(C=O)CCc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C19H18O2/c1-14-17(12-20)8-7-16-11-18(9-10-19(14)16)21-13-15-5-3-2-4-6-15/h2-6,9-12H,7-8,13H2,1H3 |
| InChIKey | XWWFLXSLPQMCDU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|