C18H16O2 — CID 10778027
6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde (PubChem CID 10778027) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde.
| Compound Name | 6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 10778027 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-phenylmethoxy-3,4-dihydronaphthalene-2-carbaldehyde |
| SMILES | O=CC1=Cc2ccc(OCc3ccccc3)cc2CC1 |
| InChI | InChI=1S/C18H16O2/c19-12-15-6-7-17-11-18(9-8-16(17)10-15)20-13-14-4-2-1-3-5-14/h1-5,8-12H,6-7,13H2 |
| InChIKey | IZPLPZZBNJAFRZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|