C17H15BO — CID 176987273
CID 176987273 (PubChem CID 176987273) has the molecular formula C17H15BO and a molecular weight of 246.12 g/mol.
| Compound Name | CID 176987273 |
|---|---|
| PubChem CID | 176987273 |
| Molecular Formula | C17H15BO |
| Molecular Weight | 246.12 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | — |
| SMILES | [B]C1=Cc2ccc(OCc3ccccc3)cc2CC1 |
| InChI | InChI=1S/C17H15BO/c18-16-8-6-15-11-17(9-7-14(15)10-16)19-12-13-4-2-1-3-5-13/h1-5,7,9-11H,6,8,12H2 |
| InChIKey | AHMNQUNSPDYVIB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.12 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|