C15H15NO — CID 18932839
6-phenylmethoxy-2,3-dihydro-1H-indole (PubChem CID 18932839) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 6-phenylmethoxy-2,3-dihydro-1H-indole.
| Compound Name | 6-phenylmethoxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 18932839 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 6-phenylmethoxy-2,3-dihydro-1H-indole |
| SMILES | c1ccc(COc2ccc3c(c2)NCC3)cc1 |
| InChI | InChI=1S/C15H15NO/c1-2-4-12(5-3-1)11-17-14-7-6-13-8-9-16-15(13)10-14/h1-7,10,16H,8-9,11H2 |
| InChIKey | FXOYDLLFRGNRMA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |