C17H20NO+ — CID 76846919
1,1-dimethyl-5-phenylmethoxy-2,3-dihydroindol-1-ium (PubChem CID 76846919) has the molecular formula C17H20NO+ and a molecular weight of 254.35 g/mol. Its IUPAC name is 1,1-dimethyl-5-phenylmethoxy-2,3-dihydroindol-1-ium.
| Compound Name | 1,1-dimethyl-5-phenylmethoxy-2,3-dihydroindol-1-ium |
|---|---|
| PubChem CID | 76846919 |
| Molecular Formula | C17H20NO+ |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1,1-dimethyl-5-phenylmethoxy-2,3-dihydroindol-1-ium |
| SMILES | C[N+]1(C)CCc2cc(OCc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H20NO/c1-18(2)11-10-15-12-16(8-9-17(15)18)19-13-14-6-4-3-5-7-14/h3-9,12H,10-11,13H2,1-2H3/q+1 |
| InChIKey | OXWKAAZCEKTYKV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|