C29H26O3 — CID 142956928
(2R)-6-phenylmethoxy-2-(4-phenylmethoxyphenyl)-3,4-dihydro-2H-chromene (PubChem CID 142956928) has the molecular formula C29H26O3 and a molecular weight of 422.52 g/mol. Its IUPAC name is (2R)-6-phenylmethoxy-2-(4-phenylmethoxyphenyl)-3,4-dihydro-2H-chromene.
| Compound Name | (2R)-6-phenylmethoxy-2-(4-phenylmethoxyphenyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 142956928 |
| Molecular Formula | C29H26O3 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (2R)-6-phenylmethoxy-2-(4-phenylmethoxyphenyl)-3,4-dihydro-2H-chromene |
| SMILES | c1ccc(COc2ccc([C@H]3CCc4cc(OCc5ccccc5)ccc4O3)cc2)cc1 |
| InChI | InChI=1S/C29H26O3/c1-3-7-22(8-4-1)20-30-26-14-11-24(12-15-26)28-17-13-25-19-27(16-18-29(25)32-28)31-21-23-9-5-2-6-10-23/h1-12,14-16,18-19,28H,13,17,20-21H2/t28-/m1/s1 |
| InChIKey | RWPZWNNDMBSFGP-MUUNZHRXSA-N |
| XLogP | 6.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |