C42H34N2O8 — CID 159522239
6-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine-3-carboxylic acid (PubChem CID 159522239) has the molecular formula C42H34N2O8 and a molecular weight of 694.74 g/mol. Its IUPAC name is 6-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine-3-carboxylic acid.
| Compound Name | 6-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159522239 |
| Molecular Formula | C42H34N2O8 |
| Molecular Weight | 694.74 g/mol |
| Exact Mass | 694.23 |
| IUPAC Name | 6-[(2-phenyl-3,4-dihydro-2H-chromen-6-yl)oxy]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc3c(c2)CCC(c2ccccc2)O3)nc1.O=C(O)c1ccc(Oc2ccc3c(c2)CCC(c2ccccc2)O3)nc1 |
| InChI | InChI=1S/2C21H17NO4/c2*23-21(24)16-7-11-20(22-13-16)25-17-8-10-19-15(12-17)6-9-18(26-19)14-4-2-1-3-5-14/h2*1-5,7-8,10-13,18H,6,9H2,(H,23,24) |
| InChIKey | MBYHJUQSCZHWCJ-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.74 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |