C26H20N4O6 — CID 173129786
6-[[2-[3-[(5-nitro-2-pyridinyl)oxy]phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine-2-carboxamide (PubChem CID 173129786) has the molecular formula C26H20N4O6 and a molecular weight of 484.47 g/mol. Its IUPAC name is 6-[[2-[3-[(5-nitro-2-pyridinyl)oxy]phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine-2-carboxamide.
| Compound Name | 6-[[2-[3-[(5-nitro-2-pyridinyl)oxy]phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 173129786 |
| Molecular Formula | C26H20N4O6 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 6-[[2-[3-[(5-nitro-2-pyridinyl)oxy]phenyl]-3,4-dihydro-2H-chromen-6-yl]oxy]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cccc(Oc2ccc3c(c2)CCC(c2cccc(Oc4ccc([N+](=O)[O-])cn4)c2)O3)n1 |
| InChI | InChI=1S/C26H20N4O6/c27-26(31)21-5-2-6-25(29-21)35-20-9-11-23-17(14-20)7-10-22(36-23)16-3-1-4-19(13-16)34-24-12-8-18(15-28-24)30(32)33/h1-6,8-9,11-15,22H,7,10H2,(H2,27,31) |
| InChIKey | LTMWWAOWQSVNDP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|