C42H36N4O12 — CID 157227084
2-(4-methoxyphenyl)-6-[(5-nitro-2-pyridinyl)oxy]-3,4-dihydro-2H-chromen-4-ol (PubChem CID 157227084) has the molecular formula C42H36N4O12 and a molecular weight of 788.77 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6-[(5-nitro-2-pyridinyl)oxy]-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(4-methoxyphenyl)-6-[(5-nitro-2-pyridinyl)oxy]-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 157227084 |
| Molecular Formula | C42H36N4O12 |
| Molecular Weight | 788.77 g/mol |
| Exact Mass | 788.23 |
| IUPAC Name | 2-(4-methoxyphenyl)-6-[(5-nitro-2-pyridinyl)oxy]-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc(C2CC(O)c3cc(Oc4ccc([N+](=O)[O-])cn4)ccc3O2)cc1.COc1ccc(C2CC(O)c3cc(Oc4ccc([N+](=O)[O-])cn4)ccc3O2)cc1 |
| InChI | InChI=1S/2C21H18N2O6/c2*1-27-15-5-2-13(3-6-15)20-11-18(24)17-10-16(7-8-19(17)29-20)28-21-9-4-14(12-22-21)23(25)26/h2*2-10,12,18,20,24H,11H2,1H3 |
| InChIKey | ATQYQUZWKSWVHZ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 207.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.77 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|