C13H13NO3S — CID 114715380
6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715380) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715380 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | COc1ccc2c(c1)C(O)CC(c1nccs1)O2 |
| InChI | InChI=1S/C13H13NO3S/c1-16-8-2-3-11-9(6-8)10(15)7-12(17-11)13-14-4-5-18-13/h2-6,10,12,15H,7H2,1H3 |
| InChIKey | GJUDLBHRJCUOSL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |