C13H14N2O2S — CID 104946802
(4S)-6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104946802) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is (4S)-6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104946802 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (4S)-6-methoxy-2-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | COc1ccc2c(c1)[C@@H](N)CC(c1nccs1)O2 |
| InChI | InChI=1S/C13H14N2O2S/c1-16-8-2-3-11-9(6-8)10(14)7-12(17-11)13-15-4-5-18-13/h2-6,10,12H,7,14H2,1H3/t10-,12?/m0/s1 |
| InChIKey | WORMKTIFRFJIMP-NUHJPDEHSA-N |
| XLogP | 2.68 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |