C30H26O3 — CID 101036078
(1S,9S)-5,13-bis(phenylmethoxy)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 101036078) has the molecular formula C30H26O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (1S,9S)-5,13-bis(phenylmethoxy)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | (1S,9S)-5,13-bis(phenylmethoxy)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 101036078 |
| Molecular Formula | C30H26O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (1S,9S)-5,13-bis(phenylmethoxy)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | c1ccc(COc2ccc3c(c2)C[C@@H]2O[C@H]3Cc3cc(OCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C30H26O3/c1-3-7-21(8-4-1)19-31-25-11-13-27-23(15-25)17-29-28-14-12-26(16-24(28)18-30(27)33-29)32-20-22-9-5-2-6-10-22/h1-16,29-30H,17-20H2/t29-,30-/m0/s1 |
| InChIKey | XWTFRMTWXCCEKP-KYJUHHDHSA-N |
| XLogP | 6.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |