C19H18O3 — CID 6709973
(4aR,10aS)-7-phenylmethoxy-2,4a,10,10a-tetrahydropyrano[3,2-b]chromene (PubChem CID 6709973) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (4aR,10aS)-7-phenylmethoxy-2,4a,10,10a-tetrahydropyrano[3,2-b]chromene.
| Compound Name | (4aR,10aS)-7-phenylmethoxy-2,4a,10,10a-tetrahydropyrano[3,2-b]chromene |
|---|---|
| PubChem CID | 6709973 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (4aR,10aS)-7-phenylmethoxy-2,4a,10,10a-tetrahydropyrano[3,2-b]chromene |
| SMILES | C1=C[C@H]2Oc3cc(OCc4ccccc4)ccc3C[C@@H]2OC1 |
| InChI | InChI=1S/C19H18O3/c1-2-5-14(6-3-1)13-21-16-9-8-15-11-19-17(7-4-10-20-19)22-18(15)12-16/h1-9,12,17,19H,10-11,13H2/t17-,19+/m1/s1 |
| InChIKey | CBBZTYRBEPYMKW-MJGOQNOKSA-N |
| XLogP | 3.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|