C19H23NO — CID 107313986
7-(4-phenylbutoxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 107313986) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is 7-(4-phenylbutoxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-(4-phenylbutoxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 107313986 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 7-(4-phenylbutoxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc(CCCCOc2ccc3c(c2)NCCC3)cc1 |
| InChI | InChI=1S/C19H23NO/c1-2-7-16(8-3-1)9-4-5-14-21-18-12-11-17-10-6-13-20-19(17)15-18/h1-3,7-8,11-12,15,20H,4-6,9-10,13-14H2 |
| InChIKey | GTAFGAHOGNFNSU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|