C13H19NO — CID 107313953
7-butoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 107313953) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 7-butoxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-butoxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 107313953 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 7-butoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | CCCCOc1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C13H19NO/c1-2-3-9-15-12-7-6-11-5-4-8-14-13(11)10-12/h6-7,10,14H,2-5,8-9H2,1H3 |
| InChIKey | DDPMJVQECUEKCJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|