C18H21NO — CID 28553513
8-(3-phenylpropoxy)-1,2,3,4-tetrahydroquinoline (PubChem CID 28553513) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 8-(3-phenylpropoxy)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-(3-phenylpropoxy)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 28553513 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 8-(3-phenylpropoxy)-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc(CCCOc2cccc3c2NCCC3)cc1 |
| InChI | InChI=1S/C18H21NO/c1-2-7-15(8-3-1)9-6-14-20-17-12-4-10-16-11-5-13-19-18(16)17/h1-4,7-8,10,12,19H,5-6,9,11,13-14H2 |
| InChIKey | WJFOVWCSTJJILH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|