C12H17NO2 — CID 61027554
3-(1,2,3,4-tetrahydroquinolin-8-yloxy)propan-1-ol (PubChem CID 61027554) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(1,2,3,4-tetrahydroquinolin-8-yloxy)propan-1-ol.
| Compound Name | 3-(1,2,3,4-tetrahydroquinolin-8-yloxy)propan-1-ol |
|---|---|
| PubChem CID | 61027554 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-(1,2,3,4-tetrahydroquinolin-8-yloxy)propan-1-ol |
| SMILES | OCCCOc1cccc2c1NCCC2 |
| InChI | InChI=1S/C12H17NO2/c14-8-3-9-15-11-6-1-4-10-5-2-7-13-12(10)11/h1,4,6,13-14H,2-3,5,7-9H2 |
| InChIKey | WSWCSURTRXOQPO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|