C13H17NO — CID 10631987
8-but-3-enoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 10631987) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 8-but-3-enoxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-but-3-enoxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 10631987 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 8-but-3-enoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | C=CCCOc1cccc2c1NCCC2 |
| InChI | InChI=1S/C13H17NO/c1-2-3-10-15-12-8-4-6-11-7-5-9-14-13(11)12/h2,4,6,8,14H,1,3,5,7,9-10H2 |
| InChIKey | HGUBYGNHNCTVDY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|