C19H22N2O2 — CID 90054251
5-[1-(phenylmethoxymethyl)azetidin-3-yl]oxy-2,3-dihydro-1H-indole (PubChem CID 90054251) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 5-[1-(phenylmethoxymethyl)azetidin-3-yl]oxy-2,3-dihydro-1H-indole.
| Compound Name | 5-[1-(phenylmethoxymethyl)azetidin-3-yl]oxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 90054251 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 5-[1-(phenylmethoxymethyl)azetidin-3-yl]oxy-2,3-dihydro-1H-indole |
| SMILES | c1ccc(COCN2CC(Oc3ccc4c(c3)CCN4)C2)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-2-4-15(5-3-1)13-22-14-21-11-18(12-21)23-17-6-7-19-16(10-17)8-9-20-19/h1-7,10,18,20H,8-9,11-14H2 |
| InChIKey | NAKYMPZHNHBTIW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|