About 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole
5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole (PubChem CID 114522456) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole |
| PubChem CID | 114522456 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole |
| SMILES | c1cc(OC2CC2)cc(-c2ccc3c(c2)CCN3)c1 |
| InChI | InChI=1S/C17H17NO/c1-2-12(11-16(3-1)19-15-5-6-15)13-4-7-17-14(10-13)8-9-18-17/h1-4,7,10-11,15,18H,5-6,8-9H2 |
| InChIKey | ZODYXYKEUYSIAH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole?
The IUPAC name of 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole (CID 114522456) is 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole?
The canonical SMILES for 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole is c1cc(OC2CC2)cc(-c2ccc3c(c2)CCN3)c1.
What is the InChIKey of 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole?
The InChIKey is ZODYXYKEUYSIAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO/c1-2-12(11-16(3-1)19-15-5-6-15)13-4-7-17-14(10-13)8-9-18-17/h1-4,7,10-11,15,18H,5-6,8-9H2.
What are the key properties of 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole?
5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole has a molecular weight of 251.33 g/mol, XLogP of 3.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-cyclopropyloxyphenyl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 114522456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).