C15H21NO — CID 115075220
6-cyclohexyloxy-1,2,3,4-tetrahydroquinoline (PubChem CID 115075220) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 6-cyclohexyloxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-cyclohexyloxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 115075220 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 6-cyclohexyloxy-1,2,3,4-tetrahydroquinoline |
| SMILES | c1cc2c(cc1OC1CCCCC1)CCCN2 |
| InChI | InChI=1S/C15H21NO/c1-2-6-13(7-3-1)17-14-8-9-15-12(11-14)5-4-10-16-15/h8-9,11,13,16H,1-7,10H2 |
| InChIKey | MVHIQKFJWNXVNJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|